C24H28N2O2 — CID 21406109
(E)-3-(4-propylphenyl)-N'-[(E)-3-(4-propylphenyl)prop-2-enoyl]prop-2-enehydrazide (PubChem CID 21406109) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is (E)-3-(4-propylphenyl)-N'-[(E)-3-(4-propylphenyl)prop-2-enoyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(4-propylphenyl)-N'-[(E)-3-(4-propylphenyl)prop-2-enoyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 21406109 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (E)-3-(4-propylphenyl)-N'-[(E)-3-(4-propylphenyl)prop-2-enoyl]prop-2-enehydrazide |
| SMILES | CCCc1ccc(/C=C/C(=O)NNC(=O)/C=C/c2ccc(CCC)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O2/c1-3-5-19-7-11-21(12-8-19)15-17-23(27)25-26-24(28)18-16-22-13-9-20(6-4-2)10-14-22/h7-18H,3-6H2,1-2H3,(H,25,27)(H,26,28)/b17-15+,18-16+ |
| InChIKey | IGDUEMSTOIKARQ-YTEMWHBBSA-N |
| XLogP | 4.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|