About methanol;(E)-3-(4-propylphenyl)prop-2-enal
methanol;(E)-3-(4-propylphenyl)prop-2-enal (PubChem CID 143472715) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is methanol;(E)-3-(4-propylphenyl)prop-2-enal.
Molecular Properties
| Compound Name | methanol;(E)-3-(4-propylphenyl)prop-2-enal |
| PubChem CID | 143472715 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | methanol;(E)-3-(4-propylphenyl)prop-2-enal |
| SMILES | CCCc1ccc(/C=C/C=O)cc1.CO |
| InChI | InChI=1S/C12H14O.CH4O/c1-2-4-11-6-8-12(9-7-11)5-3-10-13;1-2/h3,5-10H,2,4H2,1H3;2H,1H3/b5-3+; |
| InChIKey | PNTCCYSAWUFCID-WGCWOXMQSA-N |
| XLogP | 2.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methanol;(E)-3-(4-propylphenyl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;(E)-3-(4-propylphenyl)prop-2-enal?
The IUPAC name of methanol;(E)-3-(4-propylphenyl)prop-2-enal (CID 143472715) is methanol;(E)-3-(4-propylphenyl)prop-2-enal.
What is the SMILES notation for methanol;(E)-3-(4-propylphenyl)prop-2-enal?
The canonical SMILES for methanol;(E)-3-(4-propylphenyl)prop-2-enal is CCCc1ccc(/C=C/C=O)cc1.CO.
What is the InChIKey of methanol;(E)-3-(4-propylphenyl)prop-2-enal?
The InChIKey is PNTCCYSAWUFCID-WGCWOXMQSA-N. The full InChI is InChI=1S/C12H14O.CH4O/c1-2-4-11-6-8-12(9-7-11)5-3-10-13;1-2/h3,5-10H,2,4H2,1H3;2H,1H3/b5-3+;.
What are the key properties of methanol;(E)-3-(4-propylphenyl)prop-2-enal?
methanol;(E)-3-(4-propylphenyl)prop-2-enal has a molecular weight of 206.28 g/mol, XLogP of 2.46, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;(E)-3-(4-propylphenyl)prop-2-enal is sourced from PubChem (CID 143472715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).