About 4-propylthiobenzaldehyde
4-propylthiobenzaldehyde (PubChem CID 19091704) has the molecular formula C10H12S
and a molecular weight of 164.27 g/mol. Its IUPAC name is 4-propylthiobenzaldehyde.
Molecular Properties
| Compound Name | 4-propylthiobenzaldehyde |
| PubChem CID | 19091704 |
| Molecular Formula | C10H12S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 4-propylthiobenzaldehyde |
| SMILES | CCCc1ccc(C=S)cc1 |
| InChI | InChI=1S/C10H12S/c1-2-3-9-4-6-10(8-11)7-5-9/h4-8H,2-3H2,1H3 |
| InChIKey | ARAUXHQELUMUSS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-propylthiobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propylthiobenzaldehyde?
The IUPAC name of 4-propylthiobenzaldehyde (CID 19091704) is 4-propylthiobenzaldehyde.
What is the SMILES notation for 4-propylthiobenzaldehyde?
The canonical SMILES for 4-propylthiobenzaldehyde is CCCc1ccc(C=S)cc1.
What is the InChIKey of 4-propylthiobenzaldehyde?
The InChIKey is ARAUXHQELUMUSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12S/c1-2-3-9-4-6-10(8-11)7-5-9/h4-8H,2-3H2,1H3.
What are the key properties of 4-propylthiobenzaldehyde?
4-propylthiobenzaldehyde has a molecular weight of 164.27 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propylthiobenzaldehyde is sourced from PubChem (CID 19091704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).