C19H19NO3 — CID 11573155
2-[[(E)-3-(4-propylphenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 11573155) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-[[(E)-3-(4-propylphenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-[[(E)-3-(4-propylphenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 11573155 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-[[(E)-3-(4-propylphenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | CCCc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C19H19NO3/c1-2-5-14-8-10-15(11-9-14)12-13-18(21)20-17-7-4-3-6-16(17)19(22)23/h3-4,6-13H,2,5H2,1H3,(H,20,21)(H,22,23)/b13-12+ |
| InChIKey | OFPDZMSXEHZAGP-OUKQBFOZSA-N |
| XLogP | 3.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|