C21H21F2NO3 — CID 175283842
4,5-difluoro-2-[3-(4-pentylphenyl)prop-2-enoylamino]benzoic acid (PubChem CID 175283842) has the molecular formula C21H21F2NO3 and a molecular weight of 373.40 g/mol. Its IUPAC name is 4,5-difluoro-2-[3-(4-pentylphenyl)prop-2-enoylamino]benzoic acid.
| Compound Name | 4,5-difluoro-2-[3-(4-pentylphenyl)prop-2-enoylamino]benzoic acid |
|---|---|
| PubChem CID | 175283842 |
| Molecular Formula | C21H21F2NO3 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 4,5-difluoro-2-[3-(4-pentylphenyl)prop-2-enoylamino]benzoic acid |
| SMILES | CCCCCc1ccc(C=CC(=O)Nc2cc(F)c(F)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H21F2NO3/c1-2-3-4-5-14-6-8-15(9-7-14)10-11-20(25)24-19-13-18(23)17(22)12-16(19)21(26)27/h6-13H,2-5H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | PVRLENDPJNLQHA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|