C20H21NO5 — CID 67889860
2-[[(E)-3-[3,4-bis(1-hydroxyethyl)phenyl]prop-2-enoyl]amino]benzoic acid (PubChem CID 67889860) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[[(E)-3-[3,4-bis(1-hydroxyethyl)phenyl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-[[(E)-3-[3,4-bis(1-hydroxyethyl)phenyl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 67889860 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[[(E)-3-[3,4-bis(1-hydroxyethyl)phenyl]prop-2-enoyl]amino]benzoic acid |
| SMILES | CC(O)c1ccc(/C=C/C(=O)Nc2ccccc2C(=O)O)cc1C(C)O |
| InChI | InChI=1S/C20H21NO5/c1-12(22)15-9-7-14(11-17(15)13(2)23)8-10-19(24)21-18-6-4-3-5-16(18)20(25)26/h3-13,22-23H,1-2H3,(H,21,24)(H,25,26)/b10-8+ |
| InChIKey | GKKHSKSADQKMFP-CSKARUKUSA-N |
| XLogP | 3.14 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|