C18H17ClN2O2 — CID 9037519
2-chloro-N'-[(E)-3-(4-ethylphenyl)prop-2-enoyl]benzohydrazide (PubChem CID 9037519) has the molecular formula C18H17ClN2O2 and a molecular weight of 328.80 g/mol. Its IUPAC name is 2-chloro-N'-[(E)-3-(4-ethylphenyl)prop-2-enoyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[(E)-3-(4-ethylphenyl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 9037519 |
| Molecular Formula | C18H17ClN2O2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-chloro-N'-[(E)-3-(4-ethylphenyl)prop-2-enoyl]benzohydrazide |
| SMILES | CCc1ccc(/C=C/C(=O)NNC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C18H17ClN2O2/c1-2-13-7-9-14(10-8-13)11-12-17(22)20-21-18(23)15-5-3-4-6-16(15)19/h3-12H,2H2,1H3,(H,20,22)(H,21,23)/b12-11+ |
| InChIKey | QIFRSVZOMVVKQP-VAWYXSNFSA-N |
| XLogP | 3.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|