C16H11BrO3 — CID 24824993
3-[(E)-3-(3-bromophenyl)prop-2-enoyl]-2-hydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 24824993) has the molecular formula C16H11BrO3 and a molecular weight of 331.17 g/mol. Its IUPAC name is 3-[(E)-3-(3-bromophenyl)prop-2-enoyl]-2-hydroxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 3-[(E)-3-(3-bromophenyl)prop-2-enoyl]-2-hydroxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 24824993 |
| Molecular Formula | C16H11BrO3 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 3-[(E)-3-(3-bromophenyl)prop-2-enoyl]-2-hydroxycyclohepta-2,4,6-trien-1-one |
| SMILES | O=C(/C=C/c1cccc(Br)c1)c1ccccc(=O)c1O |
| InChI | InChI=1S/C16H11BrO3/c17-12-5-3-4-11(10-12)8-9-14(18)13-6-1-2-7-15(19)16(13)20/h1-10H,(H,19,20)/b9-8+ |
| InChIKey | VYXPRNHERPGBMS-CMDGGOBGSA-N |
| XLogP | 3.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|