C17H12Br2O3 — CID 136736977
5,7-dibromo-2-hydroxy-3-[(Z)-3-(3-methylphenyl)prop-2-enoyl]cyclohepta-2,4,6-trien-1-one (PubChem CID 136736977) has the molecular formula C17H12Br2O3 and a molecular weight of 424.09 g/mol. Its IUPAC name is 5,7-dibromo-2-hydroxy-3-[(Z)-3-(3-methylphenyl)prop-2-enoyl]cyclohepta-2,4,6-trien-1-one.
| Compound Name | 5,7-dibromo-2-hydroxy-3-[(Z)-3-(3-methylphenyl)prop-2-enoyl]cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 136736977 |
| Molecular Formula | C17H12Br2O3 |
| Molecular Weight | 424.09 g/mol |
| Exact Mass | 421.92 |
| IUPAC Name | 5,7-dibromo-2-hydroxy-3-[(Z)-3-(3-methylphenyl)prop-2-enoyl]cyclohepta-2,4,6-trien-1-one |
| SMILES | Cc1cccc(/C=C\C(=O)c2cc(Br)cc(Br)c(=O)c2O)c1 |
| InChI | InChI=1S/C17H12Br2O3/c1-10-3-2-4-11(7-10)5-6-15(20)13-8-12(18)9-14(19)17(22)16(13)21/h2-9H,1H3,(H,21,22)/b6-5- |
| InChIKey | CWWYYQVEMJZDJJ-WAYWQWQTSA-N |
| XLogP | 4.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.09 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|