C16H12Br2O3 — CID 12680387
(E)-1-(3,5-dibromo-2-hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 12680387) has the molecular formula C16H12Br2O3 and a molecular weight of 412.08 g/mol. Its IUPAC name is (E)-1-(3,5-dibromo-2-hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(3,5-dibromo-2-hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 12680387 |
| Molecular Formula | C16H12Br2O3 |
| Molecular Weight | 412.08 g/mol |
| Exact Mass | 409.92 |
| IUPAC Name | (E)-1-(3,5-dibromo-2-hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C16H12Br2O3/c1-21-12-5-2-10(3-6-12)4-7-15(19)13-8-11(17)9-14(18)16(13)20/h2-9,20H,1H3/b7-4+ |
| InChIKey | YKWBUSHVZJUJRP-QPJJXVBHSA-N |
| XLogP | 4.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.08 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|