C19H20O2 — CID 3441199
3-(4-methoxyphenyl)-1-(2,4,5-trimethylphenyl)prop-2-en-1-one (PubChem CID 3441199) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-(2,4,5-trimethylphenyl)prop-2-en-1-one.
| Compound Name | 3-(4-methoxyphenyl)-1-(2,4,5-trimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3441199 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-(2,4,5-trimethylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2cc(C)c(C)cc2C)cc1 |
| InChI | InChI=1S/C19H20O2/c1-13-11-15(3)18(12-14(13)2)19(20)10-7-16-5-8-17(21-4)9-6-16/h5-12H,1-4H3 |
| InChIKey | YOVVUDYRGHKOOO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|