C17H13O5- — CID 54710111
4-carboxy-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenolate (PubChem CID 54710111) has the molecular formula C17H13O5- and a molecular weight of 297.29 g/mol. Its IUPAC name is 4-carboxy-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenolate.
| Compound Name | 4-carboxy-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenolate |
|---|---|
| PubChem CID | 54710111 |
| Molecular Formula | C17H13O5- |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 4-carboxy-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenolate |
| SMILES | COc1ccc(/C=C/C(=O)c2cc(C(=O)O)ccc2[O-])cc1 |
| InChI | InChI=1S/C17H14O5/c1-22-13-6-2-11(3-7-13)4-8-15(18)14-10-12(17(20)21)5-9-16(14)19/h2-10,19H,1H3,(H,20,21)/p-1/b8-4+ |
| InChIKey | BIQQOVRJGZSEIO-XBXARRHUSA-M |
| XLogP | 2.36 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|