C18H17ClO3 — CID 4230109
3-(4-chlorophenyl)-1-(4,5-dimethoxy-2-methylphenyl)prop-2-en-1-one (PubChem CID 4230109) has the molecular formula C18H17ClO3 and a molecular weight of 316.78 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(4,5-dimethoxy-2-methylphenyl)prop-2-en-1-one.
| Compound Name | 3-(4-chlorophenyl)-1-(4,5-dimethoxy-2-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4230109 |
| Molecular Formula | C18H17ClO3 |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(4,5-dimethoxy-2-methylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C)c(C(=O)C=Cc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C18H17ClO3/c1-12-10-17(21-2)18(22-3)11-15(12)16(20)9-6-13-4-7-14(19)8-5-13/h4-11H,1-3H3 |
| InChIKey | IWOQAYQIFZMZFK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|