C18H15ClO5 — CID 54361582
5-[3-(4-chlorophenyl)prop-2-enoyl]-2,4-dimethoxybenzoic acid (PubChem CID 54361582) has the molecular formula C18H15ClO5 and a molecular weight of 346.77 g/mol. Its IUPAC name is 5-[3-(4-chlorophenyl)prop-2-enoyl]-2,4-dimethoxybenzoic acid.
| Compound Name | 5-[3-(4-chlorophenyl)prop-2-enoyl]-2,4-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 54361582 |
| Molecular Formula | C18H15ClO5 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 5-[3-(4-chlorophenyl)prop-2-enoyl]-2,4-dimethoxybenzoic acid |
| SMILES | COc1cc(OC)c(C(=O)C=Cc2ccc(Cl)cc2)cc1C(=O)O |
| InChI | InChI=1S/C18H15ClO5/c1-23-16-10-17(24-2)14(18(21)22)9-13(16)15(20)8-5-11-3-6-12(19)7-4-11/h3-10H,1-2H3,(H,21,22) |
| InChIKey | UMWKUBNXOVMMOW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|