C19H17ClO4 — CID 87118213
4-[3-(4-chlorophenyl)prop-2-enoyl]-3-methoxy-2,6-dimethylbenzoic acid (PubChem CID 87118213) has the molecular formula C19H17ClO4 and a molecular weight of 344.79 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)prop-2-enoyl]-3-methoxy-2,6-dimethylbenzoic acid.
| Compound Name | 4-[3-(4-chlorophenyl)prop-2-enoyl]-3-methoxy-2,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 87118213 |
| Molecular Formula | C19H17ClO4 |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 4-[3-(4-chlorophenyl)prop-2-enoyl]-3-methoxy-2,6-dimethylbenzoic acid |
| SMILES | COc1c(C(=O)C=Cc2ccc(Cl)cc2)cc(C)c(C(=O)O)c1C |
| InChI | InChI=1S/C19H17ClO4/c1-11-10-15(18(24-3)12(2)17(11)19(22)23)16(21)9-6-13-4-7-14(20)8-5-13/h4-10H,1-3H3,(H,22,23) |
| InChIKey | DZDLTFKUTHFHOX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|