C21H21ClO5 — CID 150170296
4-[3-(4-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethyl-3-propan-2-yloxybenzoic acid (PubChem CID 150170296) has the molecular formula C21H21ClO5 and a molecular weight of 388.85 g/mol. Its IUPAC name is 4-[3-(4-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethyl-3-propan-2-yloxybenzoic acid.
| Compound Name | 4-[3-(4-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethyl-3-propan-2-yloxybenzoic acid |
|---|---|
| PubChem CID | 150170296 |
| Molecular Formula | C21H21ClO5 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 4-[3-(4-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethyl-3-propan-2-yloxybenzoic acid |
| SMILES | Cc1cc(C=CC(=O)c2ccc(Cl)cc2O)c(OC(C)C)c(C)c1C(=O)O |
| InChI | InChI=1S/C21H21ClO5/c1-11(2)27-20-13(4)19(21(25)26)12(3)9-14(20)5-8-17(23)16-7-6-15(22)10-18(16)24/h5-11,24H,1-4H3,(H,25,26) |
| InChIKey | FJHGEZHEKOTGPQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|