C22H24O4S — CID 87603411
2,6-dimethyl-4-[(E)-3-(2-methylsulfanylphenyl)-3-oxoprop-1-enyl]-3-propan-2-yloxybenzoic acid (PubChem CID 87603411) has the molecular formula C22H24O4S and a molecular weight of 384.50 g/mol. Its IUPAC name is 2,6-dimethyl-4-[(E)-3-(2-methylsulfanylphenyl)-3-oxoprop-1-enyl]-3-propan-2-yloxybenzoic acid.
| Compound Name | 2,6-dimethyl-4-[(E)-3-(2-methylsulfanylphenyl)-3-oxoprop-1-enyl]-3-propan-2-yloxybenzoic acid |
|---|---|
| PubChem CID | 87603411 |
| Molecular Formula | C22H24O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2,6-dimethyl-4-[(E)-3-(2-methylsulfanylphenyl)-3-oxoprop-1-enyl]-3-propan-2-yloxybenzoic acid |
| SMILES | CSc1ccccc1C(=O)/C=C/c1cc(C)c(C(=O)O)c(C)c1OC(C)C |
| InChI | InChI=1S/C22H24O4S/c1-13(2)26-21-15(4)20(22(24)25)14(3)12-16(21)10-11-18(23)17-8-6-7-9-19(17)27-5/h6-13H,1-5H3,(H,24,25)/b11-10+ |
| InChIKey | KORGSRMHQVNODE-ZHACJKMWSA-N |
| XLogP | 5.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|