C24H18O6S2 — CID 23586491
2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid (PubChem CID 23586491) has the molecular formula C24H18O6S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is 2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid.
| Compound Name | 2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid |
|---|---|
| PubChem CID | 23586491 |
| Molecular Formula | C24H18O6S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid |
| SMILES | CSc1ccccc1C(=O)c1cc(C(=O)O)c(C(=O)c2ccccc2SC)cc1C(=O)O |
| InChI | InChI=1S/C24H18O6S2/c1-31-19-9-5-3-7-13(19)21(25)15-11-18(24(29)30)16(12-17(15)23(27)28)22(26)14-8-4-6-10-20(14)32-2/h3-12H,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | NYHUSHZSFIOLBK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |