2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid

C24H18O6S2 — CID 23586491

IUPAC2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid
SMILESCSc1ccccc1C(=O)c1cc(C(=O)O)c(C(=O)c2ccccc2SC)cc1C(=O)O
InChIInChI=1S/C24H18O6S2/c1-31-19-9-5-3-7-13(19)21(25)15-11-18(24(29)30)16(12-17(15)23(27)28)22(26)14-8-4-6-10-20(14)32-2/h3-12H,1-2H3,(H,27,28)(H,29,30)
InChIKeyNYHUSHZSFIOLBK-UHFFFAOYSA-N
MW466.54 g/mol
LogP4.99
Rot. Bonds8

About 2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid

2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid (PubChem CID 23586491) has the molecular formula C24H18O6S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is 2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid.

Molecular Properties

Compound Name2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid
PubChem CID23586491
Molecular FormulaC24H18O6S2
Molecular Weight466.54 g/mol
Exact Mass466.05
IUPAC Name2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid
SMILESCSc1ccccc1C(=O)c1cc(C(=O)O)c(C(=O)c2ccccc2SC)cc1C(=O)O
InChIInChI=1S/C24H18O6S2/c1-31-19-9-5-3-7-13(19)21(25)15-11-18(24(29)30)16(12-17(15)23(27)28)22(26)14-8-4-6-10-20(14)32-2/h3-12H,1-2H3,(H,27,28)(H,29,30)
InChIKeyNYHUSHZSFIOLBK-UHFFFAOYSA-N
XLogP4.99
TPSA108.74 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms32
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500466.54
LogP ≤ 54.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid?
The IUPAC name of 2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid (CID 23586491) is 2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid.
What is the SMILES notation for 2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid?
The canonical SMILES for 2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid is CSc1ccccc1C(=O)c1cc(C(=O)O)c(C(=O)c2ccccc2SC)cc1C(=O)O.
What is the InChIKey of 2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid?
The InChIKey is NYHUSHZSFIOLBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18O6S2/c1-31-19-9-5-3-7-13(19)21(25)15-11-18(24(29)30)16(12-17(15)23(27)28)22(26)14-8-4-6-10-20(14)32-2/h3-12H,1-2H3,(H,27,28)(H,29,30).
What are the key properties of 2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid?
2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid has a molecular weight of 466.54 g/mol, XLogP of 4.99, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(2-methylsulfanylbenzoyl)terephthalic acid is sourced from PubChem (CID 23586491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).