About 2-methylsulfanylbenzoate
2-methylsulfanylbenzoate (PubChem CID 6932478) has the molecular formula C8H7O2S-
and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-methylsulfanylbenzoate.
Molecular Properties
| Compound Name | 2-methylsulfanylbenzoate |
| PubChem CID | 6932478 |
| Molecular Formula | C8H7O2S- |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 2-methylsulfanylbenzoate |
| SMILES | CSc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C8H8O2S/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10)/p-1 |
| InChIKey | LWJQGKJCZOGGPJ-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylsulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylbenzoate?
The IUPAC name of 2-methylsulfanylbenzoate (CID 6932478) is 2-methylsulfanylbenzoate.
What is the SMILES notation for 2-methylsulfanylbenzoate?
The canonical SMILES for 2-methylsulfanylbenzoate is CSc1ccccc1C(=O)[O-].
What is the InChIKey of 2-methylsulfanylbenzoate?
The InChIKey is LWJQGKJCZOGGPJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8O2S/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10)/p-1.
What are the key properties of 2-methylsulfanylbenzoate?
2-methylsulfanylbenzoate has a molecular weight of 167.21 g/mol, XLogP of 0.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylbenzoate is sourced from PubChem (CID 6932478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).