C14H10Cl2OS — CID 79214960
(2,4-dichlorophenyl)-(2-methylsulfanylphenyl)methanone (PubChem CID 79214960) has the molecular formula C14H10Cl2OS and a molecular weight of 297.21 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(2-methylsulfanylphenyl)methanone.
| Compound Name | (2,4-dichlorophenyl)-(2-methylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 79214960 |
| Molecular Formula | C14H10Cl2OS |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | (2,4-dichlorophenyl)-(2-methylsulfanylphenyl)methanone |
| SMILES | CSc1ccccc1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl2OS/c1-18-13-5-3-2-4-11(13)14(17)10-7-6-9(15)8-12(10)16/h2-8H,1H3 |
| InChIKey | NYZSRKCMPLABKW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |