C23H25ClO6 — CID 142671532
3-[4-tert-butyl-2-[(E)-3-(4-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-5-hydroxyphenoxy]butanoic acid (PubChem CID 142671532) has the molecular formula C23H25ClO6 and a molecular weight of 432.90 g/mol. Its IUPAC name is 3-[4-tert-butyl-2-[(E)-3-(4-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-5-hydroxyphenoxy]butanoic acid.
| Compound Name | 3-[4-tert-butyl-2-[(E)-3-(4-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-5-hydroxyphenoxy]butanoic acid |
|---|---|
| PubChem CID | 142671532 |
| Molecular Formula | C23H25ClO6 |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 3-[4-tert-butyl-2-[(E)-3-(4-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-5-hydroxyphenoxy]butanoic acid |
| SMILES | CC(CC(=O)O)Oc1cc(O)c(C(C)(C)C)cc1/C=C/C(=O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C23H25ClO6/c1-13(9-22(28)29)30-21-12-20(27)17(23(2,3)4)10-14(21)5-8-18(25)16-7-6-15(24)11-19(16)26/h5-8,10-13,26-27H,9H2,1-4H3,(H,28,29)/b8-5+ |
| InChIKey | YVTYFSYJVDJMHF-VMPITWQZSA-N |
| XLogP | 5.19 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|