C19H17ClO7 — CID 87118326
5-[(E)-3-(4-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-2,3-dihydroxy-4-propan-2-yloxybenzoic acid (PubChem CID 87118326) has the molecular formula C19H17ClO7 and a molecular weight of 392.79 g/mol. Its IUPAC name is 5-[(E)-3-(4-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-2,3-dihydroxy-4-propan-2-yloxybenzoic acid.
| Compound Name | 5-[(E)-3-(4-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-2,3-dihydroxy-4-propan-2-yloxybenzoic acid |
|---|---|
| PubChem CID | 87118326 |
| Molecular Formula | C19H17ClO7 |
| Molecular Weight | 392.79 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 5-[(E)-3-(4-chloro-2-hydroxyphenyl)-3-oxoprop-1-enyl]-2,3-dihydroxy-4-propan-2-yloxybenzoic acid |
| SMILES | CC(C)Oc1c(/C=C/C(=O)c2ccc(Cl)cc2O)cc(C(=O)O)c(O)c1O |
| InChI | InChI=1S/C19H17ClO7/c1-9(2)27-18-10(7-13(19(25)26)16(23)17(18)24)3-6-14(21)12-5-4-11(20)8-15(12)22/h3-9,22-24H,1-2H3,(H,25,26)/b6-3+ |
| InChIKey | FCIWMCRVTHHWRO-ZZXKWVIFSA-N |
| XLogP | 3.84 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.79 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|