C21H24O4 — CID 2897593
3-(3,4,5-trimethoxyphenyl)-1-(2,4,5-trimethylphenyl)prop-2-en-1-one (PubChem CID 2897593) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)-1-(2,4,5-trimethylphenyl)prop-2-en-1-one.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)-1-(2,4,5-trimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2897593 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)-1-(2,4,5-trimethylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2cc(C)c(C)cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C21H24O4/c1-13-9-15(3)17(10-14(13)2)18(22)8-7-16-11-19(23-4)21(25-6)20(12-16)24-5/h7-12H,1-6H3 |
| InChIKey | SAFGGFQKQGZUTJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|