C21H22O7 — CID 66871110
1-(6-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 66871110) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is 1-(6-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(6-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 66871110 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-(6-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc2c(cc1C(=O)C=Cc1cc(OC)c(OC)c(OC)c1)OCCO2 |
| InChI | InChI=1S/C21H22O7/c1-23-16-12-18-17(27-7-8-28-18)11-14(16)15(22)6-5-13-9-19(24-2)21(26-4)20(10-13)25-3/h5-6,9-12H,7-8H2,1-4H3 |
| InChIKey | DKKUFUNIPQDONQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|