About CID 46855338
CID 46855338 (PubChem CID 46855338) has the molecular formula C22H22FeO4+2
and a molecular weight of 406.26 g/mol.
Molecular Properties
| Compound Name | CID 46855338 |
| PubChem CID | 46855338 |
| Molecular Formula | C22H22FeO4+2 |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | — |
| SMILES | COc1cc(/C=C/C(=O)[C]2[CH][CH][CH][CH]2)cc(OC)c1OC.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C17H17O4.C5H5.Fe/c1-19-15-10-12(11-16(20-2)17(15)21-3)8-9-14(18)13-6-4-5-7-13;1-2-4-5-3-1;/h4-11H,1-3H3;1-5H;/q;;+2/b9-8+;; |
| InChIKey | ZKATZKDQYVNUTD-YEUQMBKVSA-N |
| XLogP | 3.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 46855338 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 46855338?
The IUPAC name of CID 46855338 (CID 46855338) is not available.
What is the SMILES notation for CID 46855338?
The canonical SMILES for CID 46855338 is COc1cc(/C=C/C(=O)[C]2[CH][CH][CH][CH]2)cc(OC)c1OC.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 46855338?
The InChIKey is ZKATZKDQYVNUTD-YEUQMBKVSA-N. The full InChI is InChI=1S/C17H17O4.C5H5.Fe/c1-19-15-10-12(11-16(20-2)17(15)21-3)8-9-14(18)13-6-4-5-7-13;1-2-4-5-3-1;/h4-11H,1-3H3;1-5H;/q;;+2/b9-8+;;.
What are the key properties of CID 46855338?
CID 46855338 has a molecular weight of 406.26 g/mol, XLogP of 3.72, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 46855338 is sourced from PubChem (CID 46855338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).