C20H19ClO6 — CID 31473134
(E)-1-(5-chloro-2,4-dimethoxyphenyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one (PubChem CID 31473134) has the molecular formula C20H19ClO6 and a molecular weight of 390.82 g/mol. Its IUPAC name is (E)-1-(5-chloro-2,4-dimethoxyphenyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(5-chloro-2,4-dimethoxyphenyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 31473134 |
| Molecular Formula | C20H19ClO6 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (E)-1-(5-chloro-2,4-dimethoxyphenyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one |
| SMILES | COc1cc(OC)c(C(=O)/C=C/c2cc(OC)c3c(c2)OCCO3)cc1Cl |
| InChI | InChI=1S/C20H19ClO6/c1-23-16-11-17(24-2)14(21)10-13(16)15(22)5-4-12-8-18(25-3)20-19(9-12)26-6-7-27-20/h4-5,8-11H,6-7H2,1-3H3/b5-4+ |
| InChIKey | VPSDYWQTACKZKO-SNAWJCMRSA-N |
| XLogP | 4.03 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|