C19H15NO5 — CID 16559496
(4-cyanophenyl) (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate (PubChem CID 16559496) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is (4-cyanophenyl) (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate.
| Compound Name | (4-cyanophenyl) (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate |
|---|---|
| PubChem CID | 16559496 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (4-cyanophenyl) (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2ccc(C#N)cc2)cc2c1OCCO2 |
| InChI | InChI=1S/C19H15NO5/c1-22-16-10-14(11-17-19(16)24-9-8-23-17)4-7-18(21)25-15-5-2-13(12-20)3-6-15/h2-7,10-11H,8-9H2,1H3/b7-4+ |
| InChIKey | OQWMTGCRQFTJTD-QPJJXVBHSA-N |
| XLogP | 2.96 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|