C18H18O4S — CID 34049102
(E)-1-(5-ethylthiophen-2-yl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one (PubChem CID 34049102) has the molecular formula C18H18O4S and a molecular weight of 330.41 g/mol. Its IUPAC name is (E)-1-(5-ethylthiophen-2-yl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(5-ethylthiophen-2-yl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 34049102 |
| Molecular Formula | C18H18O4S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (E)-1-(5-ethylthiophen-2-yl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one |
| SMILES | CCc1ccc(C(=O)/C=C/c2cc(OC)c3c(c2)OCCO3)s1 |
| InChI | InChI=1S/C18H18O4S/c1-3-13-5-7-17(23-13)14(19)6-4-12-10-15(20-2)18-16(11-12)21-8-9-22-18/h4-7,10-11H,3,8-9H2,1-2H3/b6-4+ |
| InChIKey | SEDAVURVSGGUJS-GQCTYLIASA-N |
| XLogP | 3.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|