C13H16O3 — CID 142599018
7-[(E)-but-1-enyl]-5-methoxy-2,3-dihydro-1,4-benzodioxine (PubChem CID 142599018) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 7-[(E)-but-1-enyl]-5-methoxy-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 7-[(E)-but-1-enyl]-5-methoxy-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 142599018 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 7-[(E)-but-1-enyl]-5-methoxy-2,3-dihydro-1,4-benzodioxine |
| SMILES | CC/C=C/c1cc(OC)c2c(c1)OCCO2 |
| InChI | InChI=1S/C13H16O3/c1-3-4-5-10-8-11(14-2)13-12(9-10)15-6-7-16-13/h4-5,8-9H,3,6-7H2,1-2H3/b5-4+ |
| InChIKey | ASCPYYYAFGNTRD-SNAWJCMRSA-N |
| XLogP | 2.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |