C17H21NO6 — CID 91943985
2-[3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoylamino]pentanoic acid (PubChem CID 91943985) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-[3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoylamino]pentanoic acid.
| Compound Name | 2-[3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoylamino]pentanoic acid |
|---|---|
| PubChem CID | 91943985 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-[3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoylamino]pentanoic acid |
| SMILES | CCCC(NC(=O)C=Cc1cc(OC)c2c(c1)OCCO2)C(=O)O |
| InChI | InChI=1S/C17H21NO6/c1-3-4-12(17(20)21)18-15(19)6-5-11-9-13(22-2)16-14(10-11)23-7-8-24-16/h5-6,9-10,12H,3-4,7-8H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | COUJCYHUVZGCAS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|