C22H24O7 — CID 8675251
2-(4-ethoxyphenoxy)ethyl (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate (PubChem CID 8675251) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)ethyl (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate.
| Compound Name | 2-(4-ethoxyphenoxy)ethyl (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8675251 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-(4-ethoxyphenoxy)ethyl (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate |
| SMILES | CCOc1ccc(OCCOC(=O)/C=C/c2cc(OC)c3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C22H24O7/c1-3-25-17-5-7-18(8-6-17)26-10-12-28-21(23)9-4-16-14-19(24-2)22-20(15-16)27-11-13-29-22/h4-9,14-15H,3,10-13H2,1-2H3/b9-4+ |
| InChIKey | GFHYQDXXQPPKNI-RUDMXATFSA-N |
| XLogP | 3.50 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|