C20H19ClO6 — CID 8992572
(5-chloro-2-methoxyphenyl)methyl (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate (PubChem CID 8992572) has the molecular formula C20H19ClO6 and a molecular weight of 390.82 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)methyl (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate.
| Compound Name | (5-chloro-2-methoxyphenyl)methyl (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8992572 |
| Molecular Formula | C20H19ClO6 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)methyl (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate |
| SMILES | COc1ccc(Cl)cc1COC(=O)/C=C/c1cc(OC)c2c(c1)OCCO2 |
| InChI | InChI=1S/C20H19ClO6/c1-23-16-5-4-15(21)11-14(16)12-27-19(22)6-3-13-9-17(24-2)20-18(10-13)25-7-8-26-20/h3-6,9-11H,7-8,12H2,1-2H3/b6-3+ |
| InChIKey | HRLXHENANSNLFV-ZZXKWVIFSA-N |
| XLogP | 3.88 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|