C19H15F3O4 — CID 52643888
(E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 52643888) has the molecular formula C19H15F3O4 and a molecular weight of 364.32 g/mol. Its IUPAC name is (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 52643888 |
| Molecular Formula | C19H15F3O4 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(C(F)(F)F)cc2)cc2c1OCCO2 |
| InChI | InChI=1S/C19H15F3O4/c1-24-16-10-12(11-17-18(16)26-9-8-25-17)2-7-15(23)13-3-5-14(6-4-13)19(20,21)22/h2-7,10-11H,8-9H2,1H3/b7-2+ |
| InChIKey | ULHPNUGJCLMWSA-FARCUNLSSA-N |
| XLogP | 4.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|