C19H19ClO3 — CID 6218970
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-(3,4-dimethylphenyl)prop-2-en-1-one (PubChem CID 6218970) has the molecular formula C19H19ClO3 and a molecular weight of 330.81 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-(3,4-dimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-(3,4-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6218970 |
| Molecular Formula | C19H19ClO3 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-(3,4-dimethylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(C)c(C)c2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H19ClO3/c1-12-5-7-15(9-13(12)2)17(21)8-6-14-10-16(20)19(23-4)18(11-14)22-3/h5-11H,1-4H3/b8-6+ |
| InChIKey | OULSJLUMDHMDGH-SOFGYWHQSA-N |
| XLogP | 4.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|