C22H25ClO6 — CID 4824259
3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 4824259) has the molecular formula C22H25ClO6 and a molecular weight of 420.89 g/mol. Its IUPAC name is 3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4824259 |
| Molecular Formula | C22H25ClO6 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2cc(OC)c(OC)c(OC)c2)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C22H25ClO6/c1-13(2)29-21-16(23)9-14(10-18(21)25-3)7-8-17(24)15-11-19(26-4)22(28-6)20(12-15)27-5/h7-13H,1-6H3 |
| InChIKey | JJLHLRQJNZSNIK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|