C18H17ClO6 — CID 73390374
3-(3-chloro-4,5-dihydroxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 73390374) has the molecular formula C18H17ClO6 and a molecular weight of 364.78 g/mol. Its IUPAC name is 3-(3-chloro-4,5-dihydroxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(3-chloro-4,5-dihydroxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 73390374 |
| Molecular Formula | C18H17ClO6 |
| Molecular Weight | 364.78 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 3-(3-chloro-4,5-dihydroxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)C=Cc2cc(O)c(O)c(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H17ClO6/c1-23-15-8-11(9-16(24-2)18(15)25-3)13(20)5-4-10-6-12(19)17(22)14(21)7-10/h4-9,21-22H,1-3H3 |
| InChIKey | SZJWKDVWKKBRNR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.78 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|