C24H22ClNO3 — CID 175987782
(E)-1-[3-[(benzylamino)methyl]-2-hydroxy-4-methoxyphenyl]-3-(4-chlorophenyl)prop-2-en-1-one (PubChem CID 175987782) has the molecular formula C24H22ClNO3 and a molecular weight of 407.90 g/mol. Its IUPAC name is (E)-1-[3-[(benzylamino)methyl]-2-hydroxy-4-methoxyphenyl]-3-(4-chlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-[(benzylamino)methyl]-2-hydroxy-4-methoxyphenyl]-3-(4-chlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 175987782 |
| Molecular Formula | C24H22ClNO3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (E)-1-[3-[(benzylamino)methyl]-2-hydroxy-4-methoxyphenyl]-3-(4-chlorophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(Cl)cc2)c(O)c1CNCc1ccccc1 |
| InChI | InChI=1S/C24H22ClNO3/c1-29-23-14-12-20(22(27)13-9-17-7-10-19(25)11-8-17)24(28)21(23)16-26-15-18-5-3-2-4-6-18/h2-14,26,28H,15-16H2,1H3/b13-9+ |
| InChIKey | CFTIEOSUFZEBRM-UKTHLTGXSA-N |
| XLogP | 5.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|