C26H23ClO3 — CID 70681862
(E)-3-(4-chlorophenyl)-1-(2,2-dimethyl-4-phenylmethoxy-3H-1-benzofuran-7-yl)prop-2-en-1-one (PubChem CID 70681862) has the molecular formula C26H23ClO3 and a molecular weight of 418.92 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-(2,2-dimethyl-4-phenylmethoxy-3H-1-benzofuran-7-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-(2,2-dimethyl-4-phenylmethoxy-3H-1-benzofuran-7-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 70681862 |
| Molecular Formula | C26H23ClO3 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-(2,2-dimethyl-4-phenylmethoxy-3H-1-benzofuran-7-yl)prop-2-en-1-one |
| SMILES | CC1(C)Cc2c(OCc3ccccc3)ccc(C(=O)/C=C/c3ccc(Cl)cc3)c2O1 |
| InChI | InChI=1S/C26H23ClO3/c1-26(2)16-22-24(29-17-19-6-4-3-5-7-19)15-13-21(25(22)30-26)23(28)14-10-18-8-11-20(27)12-9-18/h3-15H,16-17H2,1-2H3/b14-10+ |
| InChIKey | AHAAJQIHUFILPR-GXDHUFHOSA-N |
| XLogP | 6.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|