C28H29ClN2O3 — CID 175987752
(E)-1-[3-[(2-benzylpiperazin-1-yl)methyl]-2-hydroxy-4-methoxyphenyl]-3-(4-chlorophenyl)prop-2-en-1-one (PubChem CID 175987752) has the molecular formula C28H29ClN2O3 and a molecular weight of 477.00 g/mol. Its IUPAC name is (E)-1-[3-[(2-benzylpiperazin-1-yl)methyl]-2-hydroxy-4-methoxyphenyl]-3-(4-chlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-[(2-benzylpiperazin-1-yl)methyl]-2-hydroxy-4-methoxyphenyl]-3-(4-chlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 175987752 |
| Molecular Formula | C28H29ClN2O3 |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (E)-1-[3-[(2-benzylpiperazin-1-yl)methyl]-2-hydroxy-4-methoxyphenyl]-3-(4-chlorophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(Cl)cc2)c(O)c1CN1CCNCC1Cc1ccccc1 |
| InChI | InChI=1S/C28H29ClN2O3/c1-34-27-14-12-24(26(32)13-9-20-7-10-22(29)11-8-20)28(33)25(27)19-31-16-15-30-18-23(31)17-21-5-3-2-4-6-21/h2-14,23,30,33H,15-19H2,1H3/b13-9+ |
| InChIKey | TYHGCSDFYQRIJS-UKTHLTGXSA-N |
| XLogP | 4.97 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|