C22H18O4 — CID 23110678
(E)-1-(3-benzyl-2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 23110678) has the molecular formula C22H18O4 and a molecular weight of 346.38 g/mol. Its IUPAC name is (E)-1-(3-benzyl-2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(3-benzyl-2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 23110678 |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (E)-1-(3-benzyl-2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(O)cc1)c1ccc(O)c(Cc2ccccc2)c1O |
| InChI | InChI=1S/C22H18O4/c23-17-9-6-15(7-10-17)8-12-20(24)18-11-13-21(25)19(22(18)26)14-16-4-2-1-3-5-16/h1-13,23,25-26H,14H2/b12-8+ |
| InChIKey | HSQFQCVOPIFBBZ-XYOKQWHBSA-N |
| XLogP | 4.29 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|