C20H21ClO4 — CID 71601899
(E)-1-[3-(3-chloro-3-methylbutyl)-2,4-dihydroxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 71601899) has the molecular formula C20H21ClO4 and a molecular weight of 360.84 g/mol. Its IUPAC name is (E)-1-[3-(3-chloro-3-methylbutyl)-2,4-dihydroxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-(3-chloro-3-methylbutyl)-2,4-dihydroxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71601899 |
| Molecular Formula | C20H21ClO4 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (E)-1-[3-(3-chloro-3-methylbutyl)-2,4-dihydroxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | CC(C)(Cl)CCc1c(O)ccc(C(=O)/C=C/c2ccc(O)cc2)c1O |
| InChI | InChI=1S/C20H21ClO4/c1-20(2,21)12-11-16-18(24)10-8-15(19(16)25)17(23)9-5-13-3-6-14(22)7-4-13/h3-10,22,24-25H,11-12H2,1-2H3/b9-5+ |
| InChIKey | UJDJWQKWCWQLJY-WEVVVXLNSA-N |
| XLogP | 4.65 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|