C20H19ClO4 — CID 155520011
(E)-3-(4-chlorophenyl)-1-[2,4-dihydroxy-3-(2-hydroxy-3-methylbut-3-enyl)phenyl]prop-2-en-1-one (PubChem CID 155520011) has the molecular formula C20H19ClO4 and a molecular weight of 358.82 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[2,4-dihydroxy-3-(2-hydroxy-3-methylbut-3-enyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[2,4-dihydroxy-3-(2-hydroxy-3-methylbut-3-enyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155520011 |
| Molecular Formula | C20H19ClO4 |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[2,4-dihydroxy-3-(2-hydroxy-3-methylbut-3-enyl)phenyl]prop-2-en-1-one |
| SMILES | C=C(C)C(O)Cc1c(O)ccc(C(=O)/C=C/c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C20H19ClO4/c1-12(2)19(24)11-16-18(23)10-8-15(20(16)25)17(22)9-5-13-3-6-14(21)7-4-13/h3-10,19,23-25H,1,11H2,2H3/b9-5+ |
| InChIKey | SZERMWLITATSRS-WEVVVXLNSA-N |
| XLogP | 4.13 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|