C25H28O6 — CID 163043999
1-[2,4-dihydroxy-3-[(6R)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]phenyl]-3-(3,4-dihydroxyphenyl)prop-2-en-1-one (PubChem CID 163043999) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is 1-[2,4-dihydroxy-3-[(6R)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]phenyl]-3-(3,4-dihydroxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[2,4-dihydroxy-3-[(6R)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]phenyl]-3-(3,4-dihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 163043999 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-[2,4-dihydroxy-3-[(6R)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]phenyl]-3-(3,4-dihydroxyphenyl)prop-2-en-1-one |
| SMILES | C=C(C)[C@H](O)CCC(C)=CCc1c(O)ccc(C(=O)C=Cc2ccc(O)c(O)c2)c1O |
| InChI | InChI=1S/C25H28O6/c1-15(2)20(26)10-5-16(3)4-8-18-22(28)13-9-19(25(18)31)21(27)11-6-17-7-12-23(29)24(30)14-17/h4,6-7,9,11-14,20,26,28-31H,1,5,8,10H2,2-3H3/t20-/m1/s1 |
| InChIKey | WNTGZUNFTPNYIX-HXUWFJFHSA-N |
| XLogP | 4.61 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|