C25H28O8 — CID 24824764
(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-[(2E)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]-2,3-dihydrochromen-4-one (PubChem CID 24824764) has the molecular formula C25H28O8 and a molecular weight of 456.49 g/mol. Its IUPAC name is (2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-[(2E)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]-2,3-dihydrochromen-4-one.
| Compound Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-[(2E)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 24824764 |
| Molecular Formula | C25H28O8 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-[(2E)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]-2,3-dihydrochromen-4-one |
| SMILES | C=C(C)C(O)CC/C(C)=C/Cc1c(O)cc2c(c1O)C(=O)[C@H](O)[C@@H](c1ccc(O)c(O)c1)O2 |
| InChI | InChI=1S/C25H28O8/c1-12(2)16(26)8-5-13(3)4-7-15-18(28)11-20-21(22(15)30)23(31)24(32)25(33-20)14-6-9-17(27)19(29)10-14/h4,6,9-11,16,24-30,32H,1,5,7-8H2,2-3H3/b13-4+/t16?,24-,25+/m0/s1 |
| InChIKey | NTMQNHBCKRVTCV-MZCZFRPSSA-N |
| XLogP | 3.39 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|