C25H30O7 — CID 141443481
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-[(E)-7-hydroxy-3,7-dimethyloct-2-enyl]-2,3-dihydrochromen-4-one (PubChem CID 141443481) has the molecular formula C25H30O7 and a molecular weight of 442.51 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-[(E)-7-hydroxy-3,7-dimethyloct-2-enyl]-2,3-dihydrochromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-[(E)-7-hydroxy-3,7-dimethyloct-2-enyl]-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 141443481 |
| Molecular Formula | C25H30O7 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-[(E)-7-hydroxy-3,7-dimethyloct-2-enyl]-2,3-dihydrochromen-4-one |
| SMILES | C/C(=C\Cc1c(O)cc2c(c1O)C(=O)CC(c1ccc(O)c(O)c1)O2)CCCC(C)(C)O |
| InChI | InChI=1S/C25H30O7/c1-14(5-4-10-25(2,3)31)6-8-16-18(27)12-22-23(24(16)30)20(29)13-21(32-22)15-7-9-17(26)19(28)11-15/h6-7,9,11-12,21,26-28,30-31H,4-5,8,10,13H2,1-3H3/b14-6+ |
| InChIKey | LKKMBXHWLZIZLK-MKMNVTDBSA-N |
| XLogP | 4.65 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|