C26H30O5 — CID 73085040
6-(3,7-dimethylocta-2,6-dienyl)-5,7-dihydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 73085040) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is 6-(3,7-dimethylocta-2,6-dienyl)-5,7-dihydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 6-(3,7-dimethylocta-2,6-dienyl)-5,7-dihydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 73085040 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 6-(3,7-dimethylocta-2,6-dienyl)-5,7-dihydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc(C2CC(=O)c3c(cc(O)c(CC=C(C)CCC=C(C)C)c3O)O2)cc1 |
| InChI | InChI=1S/C26H30O5/c1-16(2)6-5-7-17(3)8-13-20-21(27)14-24-25(26(20)29)22(28)15-23(31-24)18-9-11-19(30-4)12-10-18/h6,8-12,14,23,27,29H,5,7,13,15H2,1-4H3 |
| InChIKey | LKAFYCSXBIOTDY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|