C30H37O6+ — CID 163982084
[4-[(2S)-5,7-dihydroxy-6-(3-methylbut-2-enyl)-4-oxo-2,3-dihydrochromen-2-yl]-3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxyphenyl]oxidanium (PubChem CID 163982084) has the molecular formula C30H37O6+ and a molecular weight of 493.62 g/mol. Its IUPAC name is [4-[(2S)-5,7-dihydroxy-6-(3-methylbut-2-enyl)-4-oxo-2,3-dihydrochromen-2-yl]-3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxyphenyl]oxidanium.
| Compound Name | [4-[(2S)-5,7-dihydroxy-6-(3-methylbut-2-enyl)-4-oxo-2,3-dihydrochromen-2-yl]-3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxyphenyl]oxidanium |
|---|---|
| PubChem CID | 163982084 |
| Molecular Formula | C30H37O6+ |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | [4-[(2S)-5,7-dihydroxy-6-(3-methylbut-2-enyl)-4-oxo-2,3-dihydrochromen-2-yl]-3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxyphenyl]oxidanium |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c([C@@H]2CC(=O)c3c(cc(O)c(CC=C(C)C)c3O)O2)ccc([OH2+])c1O |
| InChI | InChI=1S/C30H36O6/c1-17(2)7-6-8-19(5)10-12-21-20(13-14-23(31)29(21)34)26-16-25(33)28-27(36-26)15-24(32)22(30(28)35)11-9-18(3)4/h7,9-10,13-15,26,31-32,34-35H,6,8,11-12,16H2,1-5H3/p+1/b19-10+/t26-/m0/s1 |
| InChIKey | SZHDIKOQLFZADP-XBPZWBIKSA-O |
| XLogP | 6.69 |
| TPSA | 109.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|