C27H32O7 — CID 163074365
(2S)-6-(3,7-dimethylocta-2,6-dienyl)-5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 163074365) has the molecular formula C27H32O7 and a molecular weight of 468.55 g/mol. Its IUPAC name is (2S)-6-(3,7-dimethylocta-2,6-dienyl)-5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-6-(3,7-dimethylocta-2,6-dienyl)-5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 163074365 |
| Molecular Formula | C27H32O7 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | (2S)-6-(3,7-dimethylocta-2,6-dienyl)-5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1cc([C@@H]2CC(=O)c3c(cc(O)c(CC=C(C)CCC=C(C)C)c3O)O2)cc(OC)c1O |
| InChI | InChI=1S/C27H32O7/c1-15(2)7-6-8-16(3)9-10-18-19(28)13-22-25(26(18)30)20(29)14-21(34-22)17-11-23(32-4)27(31)24(12-17)33-5/h7,9,11-13,21,28,30-31H,6,8,10,14H2,1-5H3/t21-/m0/s1 |
| InChIKey | UPBJEHBYZUPVDF-NRFANRHFSA-N |
| XLogP | 5.76 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|