C27H32O8 — CID 162856949
(2R,3R)-6-(3,7-dimethylocta-2,6-dienyl)-3,5,7-trihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 162856949) has the molecular formula C27H32O8 and a molecular weight of 484.55 g/mol. Its IUPAC name is (2R,3R)-6-(3,7-dimethylocta-2,6-dienyl)-3,5,7-trihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2R,3R)-6-(3,7-dimethylocta-2,6-dienyl)-3,5,7-trihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 162856949 |
| Molecular Formula | C27H32O8 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | (2R,3R)-6-(3,7-dimethylocta-2,6-dienyl)-3,5,7-trihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1cc([C@H]2Oc3cc(O)c(CC=C(C)CCC=C(C)C)c(O)c3C(=O)[C@@H]2O)cc(OC)c1O |
| InChI | InChI=1S/C27H32O8/c1-14(2)7-6-8-15(3)9-10-17-18(28)13-19-22(23(17)29)25(31)26(32)27(35-19)16-11-20(33-4)24(30)21(12-16)34-5/h7,9,11-13,26-30,32H,6,8,10H2,1-5H3/t26-,27+/m0/s1 |
| InChIKey | GBRWZUMUFWROIE-RRPNLBNLSA-N |
| XLogP | 4.73 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|