C31H38O8 — CID 163026378
(2R,3S)-2-(2,6-dihydroxy-4-methoxyphenyl)-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5,7-trihydroxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one (PubChem CID 163026378) has the molecular formula C31H38O8 and a molecular weight of 538.64 g/mol. Its IUPAC name is (2R,3S)-2-(2,6-dihydroxy-4-methoxyphenyl)-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5,7-trihydroxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2R,3S)-2-(2,6-dihydroxy-4-methoxyphenyl)-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5,7-trihydroxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 163026378 |
| Molecular Formula | C31H38O8 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | (2R,3S)-2-(2,6-dihydroxy-4-methoxyphenyl)-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5,7-trihydroxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1cc(O)c([C@H]2Oc3c(CC=C(C)C)c(O)c(C/C=C(\C)CCC=C(C)C)c(O)c3C(=O)[C@H]2O)c(O)c1 |
| InChI | InChI=1S/C31H38O8/c1-16(2)8-7-9-18(5)11-13-20-26(34)21(12-10-17(3)4)30-25(27(20)35)28(36)29(37)31(39-30)24-22(32)14-19(38-6)15-23(24)33/h8,10-11,14-15,29,31-35,37H,7,9,12-13H2,1-6H3/b18-11+/t29-,31-/m1/s1 |
| InChIKey | APBJBGZSMVFZOD-MJDZYGDSSA-N |
| XLogP | 5.94 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|